C8H6FN — CID 176522870
6-fluoro-1,4-dihydroindole (PubChem CID 176522870) has the molecular formula C8H6FN and a molecular weight of 135.14 g/mol. Its IUPAC name is 6-fluoro-1,4-dihydroindole.
| Compound Name | 6-fluoro-1,4-dihydroindole |
|---|---|
| PubChem CID | 176522870 |
| Molecular Formula | C8H6FN |
| Molecular Weight | 135.14 g/mol |
| Exact Mass | 135.05 |
| IUPAC Name | 6-fluoro-1,4-dihydroindole |
| SMILES | FC1=CCC2=C=CNC2=C1 |
| InChI | InChI=1S/C8H6FN/c9-7-2-1-6-3-4-10-8(6)5-7/h2,4-5,10H,1H2 |
| InChIKey | XUBNTIOPXGOBAS-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 135.14 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |