C8H6LiN — CID 134894157
lithium 1,7-dihydroindol-7-ide (PubChem CID 134894157) has the molecular formula C8H6LiN and a molecular weight of 123.08 g/mol. Its IUPAC name is lithium 1,7-dihydroindol-7-ide.
| Compound Name | lithium 1,7-dihydroindol-7-ide |
|---|---|
| PubChem CID | 134894157 |
| Molecular Formula | C8H6LiN |
| Molecular Weight | 123.08 g/mol |
| Exact Mass | 123.07 |
| IUPAC Name | lithium 1,7-dihydroindol-7-ide |
| SMILES | [Li+].[c-]1cccc2cc[nH]c12 |
| InChI | InChI=1S/C8H6N.Li/c1-2-4-8-7(3-1)5-6-9-8;/h1-3,5-6,9H;/q-1;+1 |
| InChIKey | XNHJDPCCUUONGV-UHFFFAOYSA-N |
| XLogP | -1.03 |
| TPSA | 15.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 123.08 |
| LogP ≤ 5 | -1.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|