C8H11N — CID 19835372
2,3,4,5-tetrahydro-1H-indole (PubChem CID 19835372) has the molecular formula C8H11N and a molecular weight of 121.18 g/mol. Its IUPAC name is 2,3,4,5-tetrahydro-1H-indole.
| Compound Name | 2,3,4,5-tetrahydro-1H-indole |
|---|---|
| PubChem CID | 19835372 |
| Molecular Formula | C8H11N |
| Molecular Weight | 121.18 g/mol |
| Exact Mass | 121.09 |
| IUPAC Name | 2,3,4,5-tetrahydro-1H-indole |
| SMILES | C1=CC2=C(CC1)CCN2 |
| InChI | InChI=1S/C8H11N/c1-2-4-8-7(3-1)5-6-9-8/h2,4,9H,1,3,5-6H2 |
| InChIKey | VRGBZJPZIWUWKH-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 121.18 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |