C15H11N — CID 87773111
1,2-dihydroindeno[1,2-g]indole (PubChem CID 87773111) has the molecular formula C15H11N and a molecular weight of 205.26 g/mol. Its IUPAC name is 1,2-dihydroindeno[1,2-g]indole.
| Compound Name | 1,2-dihydroindeno[1,2-g]indole |
|---|---|
| PubChem CID | 87773111 |
| Molecular Formula | C15H11N |
| Molecular Weight | 205.26 g/mol |
| Exact Mass | 205.09 |
| IUPAC Name | 1,2-dihydroindeno[1,2-g]indole |
| SMILES | C1=c2ccc3c(c2NC1)C=c1ccccc1=3 |
| InChI | InChI=1S/C15H11N/c1-2-4-12-11(3-1)9-14-13(12)6-5-10-7-8-16-15(10)14/h1-7,9,16H,8H2 |
| InChIKey | KWPIDGDWMOKZAN-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.26 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |