C15H13N — CID 87216495
1,2,3,3a-tetrahydroindeno[1,2-g]indole (PubChem CID 87216495) has the molecular formula C15H13N and a molecular weight of 207.28 g/mol. Its IUPAC name is 1,2,3,3a-tetrahydroindeno[1,2-g]indole.
| Compound Name | 1,2,3,3a-tetrahydroindeno[1,2-g]indole |
|---|---|
| PubChem CID | 87216495 |
| Molecular Formula | C15H13N |
| Molecular Weight | 207.28 g/mol |
| Exact Mass | 207.10 |
| IUPAC Name | 1,2,3,3a-tetrahydroindeno[1,2-g]indole |
| SMILES | C1=CC2CCNC2=C2C=c3ccccc3=C12 |
| InChI | InChI=1S/C15H13N/c1-2-4-12-11(3-1)9-14-13(12)6-5-10-7-8-16-15(10)14/h1-6,9-10,16H,7-8H2 |
| InChIKey | VMMUGOUUBVDDPV-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.28 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |