C10H13N — CID 67639352
6,7,8,9-tetrahydro-1H-1-benzazepine (PubChem CID 67639352) has the molecular formula C10H13N and a molecular weight of 147.22 g/mol. Its IUPAC name is 6,7,8,9-tetrahydro-1H-1-benzazepine.
| Compound Name | 6,7,8,9-tetrahydro-1H-1-benzazepine |
|---|---|
| PubChem CID | 67639352 |
| Molecular Formula | C10H13N |
| Molecular Weight | 147.22 g/mol |
| Exact Mass | 147.10 |
| IUPAC Name | 6,7,8,9-tetrahydro-1H-1-benzazepine |
| SMILES | C1=CNC2=C(C=C1)CCCC2 |
| InChI | InChI=1S/C10H13N/c1-2-7-10-9(5-1)6-3-4-8-11-10/h3-4,6,8,11H,1-2,5,7H2 |
| InChIKey | UETVLEKMWYVDNU-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 147.22 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |