C8H9F2N — CID 147930375
5,6-difluoro-2,3,4,5-tetrahydro-1H-indole (PubChem CID 147930375) has the molecular formula C8H9F2N and a molecular weight of 157.16 g/mol. Its IUPAC name is 5,6-difluoro-2,3,4,5-tetrahydro-1H-indole.
| Compound Name | 5,6-difluoro-2,3,4,5-tetrahydro-1H-indole |
|---|---|
| PubChem CID | 147930375 |
| Molecular Formula | C8H9F2N |
| Molecular Weight | 157.16 g/mol |
| Exact Mass | 157.07 |
| IUPAC Name | 5,6-difluoro-2,3,4,5-tetrahydro-1H-indole |
| SMILES | FC1=CC2=C(CCN2)CC1F |
| InChI | InChI=1S/C8H9F2N/c9-6-3-5-1-2-11-8(5)4-7(6)10/h4,6,11H,1-3H2 |
| InChIKey | IJTDLURYUPIXBP-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 157.16 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |