C14H17N — CID 57305490
1-(2-methylpropyl)-2H-2-benzazepine (PubChem CID 57305490) has the molecular formula C14H17N and a molecular weight of 199.30 g/mol. Its IUPAC name is 1-(2-methylpropyl)-2H-2-benzazepine.
| Compound Name | 1-(2-methylpropyl)-2H-2-benzazepine |
|---|---|
| PubChem CID | 57305490 |
| Molecular Formula | C14H17N |
| Molecular Weight | 199.30 g/mol |
| Exact Mass | 199.14 |
| IUPAC Name | 1-(2-methylpropyl)-2H-2-benzazepine |
| SMILES | CC(C)CC1=c2ccccc2=CC=CN1 |
| InChI | InChI=1S/C14H17N/c1-11(2)10-14-13-8-4-3-6-12(13)7-5-9-15-14/h3-9,11,15H,10H2,1-2H3 |
| InChIKey | VCUZALUTRWCTKJ-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.30 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |