C12H17FN2 — CID 155228813
(Z)-N-ethenyl-1-(6-fluoro-1,2-dihydropyridin-5-yl)pent-1-en-1-amine (PubChem CID 155228813) has the molecular formula C12H17FN2 and a molecular weight of 208.28 g/mol. Its IUPAC name is (Z)-N-ethenyl-1-(6-fluoro-1,2-dihydropyridin-5-yl)pent-1-en-1-amine.
| Compound Name | (Z)-N-ethenyl-1-(6-fluoro-1,2-dihydropyridin-5-yl)pent-1-en-1-amine |
|---|---|
| PubChem CID | 155228813 |
| Molecular Formula | C12H17FN2 |
| Molecular Weight | 208.28 g/mol |
| Exact Mass | 208.14 |
| IUPAC Name | (Z)-N-ethenyl-1-(6-fluoro-1,2-dihydropyridin-5-yl)pent-1-en-1-amine |
| SMILES | C=CN/C(=C\CCC)C1=C(F)NCC=C1 |
| InChI | InChI=1S/C12H17FN2/c1-3-5-8-11(14-4-2)10-7-6-9-15-12(10)13/h4,6-8,14-15H,2-3,5,9H2,1H3/b11-8- |
| InChIKey | RGGQWWDESJDTRY-FLIBITNWSA-N |
| XLogP | 2.74 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.28 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|