C11H13F2N — CID 167204290
(2E)-2-[(2E)-2,4-difluoropenta-2,4-dienylidene]-3,4-dimethyl-1,3-dihydropyrrole (PubChem CID 167204290) has the molecular formula C11H13F2N and a molecular weight of 197.23 g/mol. Its IUPAC name is (2E)-2-[(2E)-2,4-difluoropenta-2,4-dienylidene]-3,4-dimethyl-1,3-dihydropyrrole.
| Compound Name | (2E)-2-[(2E)-2,4-difluoropenta-2,4-dienylidene]-3,4-dimethyl-1,3-dihydropyrrole |
|---|---|
| PubChem CID | 167204290 |
| Molecular Formula | C11H13F2N |
| Molecular Weight | 197.23 g/mol |
| Exact Mass | 197.10 |
| IUPAC Name | (2E)-2-[(2E)-2,4-difluoropenta-2,4-dienylidene]-3,4-dimethyl-1,3-dihydropyrrole |
| SMILES | C=C(F)/C=C(F)\C=C1\NC=C(C)C1C |
| InChI | InChI=1S/C11H13F2N/c1-7-6-14-11(9(7)3)5-10(13)4-8(2)12/h4-6,9,14H,2H2,1,3H3/b10-4+,11-5+ |
| InChIKey | RGALJMLLWDZLEX-ZVSIBQGLSA-N |
| XLogP | 3.35 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.23 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|