C20H32FN — CID 138527427
(3Z)-4-ethenyl-N-[(1-ethyl-2-fluoro-2-methylcyclopentyl)methyl]-3-methylocta-1,3,7-trien-2-amine (PubChem CID 138527427) has the molecular formula C20H32FN and a molecular weight of 305.48 g/mol. Its IUPAC name is (3Z)-4-ethenyl-N-[(1-ethyl-2-fluoro-2-methylcyclopentyl)methyl]-3-methylocta-1,3,7-trien-2-amine.
| Compound Name | (3Z)-4-ethenyl-N-[(1-ethyl-2-fluoro-2-methylcyclopentyl)methyl]-3-methylocta-1,3,7-trien-2-amine |
|---|---|
| PubChem CID | 138527427 |
| Molecular Formula | C20H32FN |
| Molecular Weight | 305.48 g/mol |
| Exact Mass | 305.25 |
| IUPAC Name | (3Z)-4-ethenyl-N-[(1-ethyl-2-fluoro-2-methylcyclopentyl)methyl]-3-methylocta-1,3,7-trien-2-amine |
| SMILES | C=CCC/C(C=C)=C(\C)C(=C)NCC1(CC)CCCC1(C)F |
| InChI | InChI=1S/C20H32FN/c1-7-10-12-18(8-2)16(4)17(5)22-15-20(9-3)14-11-13-19(20,6)21/h7-8,22H,1-2,5,9-15H2,3-4,6H3/b18-16+ |
| InChIKey | VDDAHNXDVXPIGK-FBMGVBCBSA-N |
| XLogP | 5.87 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.48 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|