C22H36FN — CID 139423605
(7E)-6-ethyl-8-[(1E,4E)-3-ethyl-5-methylocta-1,4-dienyl]-7-(1-fluoroethenyl)-1,2,3,4,5,6-hexahydroazocine (PubChem CID 139423605) has the molecular formula C22H36FN and a molecular weight of 333.54 g/mol. Its IUPAC name is (7E)-6-ethyl-8-[(1E,4E)-3-ethyl-5-methylocta-1,4-dienyl]-7-(1-fluoroethenyl)-1,2,3,4,5,6-hexahydroazocine.
| Compound Name | (7E)-6-ethyl-8-[(1E,4E)-3-ethyl-5-methylocta-1,4-dienyl]-7-(1-fluoroethenyl)-1,2,3,4,5,6-hexahydroazocine |
|---|---|
| PubChem CID | 139423605 |
| Molecular Formula | C22H36FN |
| Molecular Weight | 333.54 g/mol |
| Exact Mass | 333.28 |
| IUPAC Name | (7E)-6-ethyl-8-[(1E,4E)-3-ethyl-5-methylocta-1,4-dienyl]-7-(1-fluoroethenyl)-1,2,3,4,5,6-hexahydroazocine |
| SMILES | C=C(F)/C1=C(\C=C\C(/C=C(\C)CCC)CC)NCCCCC1CC |
| InChI | InChI=1S/C22H36FN/c1-6-11-17(4)16-19(7-2)13-14-21-22(18(5)23)20(8-3)12-9-10-15-24-21/h13-14,16,19-20,24H,5-12,15H2,1-4H3/b14-13+,17-16+,22-21- |
| InChIKey | XKZFBMLDQHBAJI-IOBZDOISSA-N |
| XLogP | 6.85 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.54 |
| LogP ≤ 5 | 6.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|