C23H31F2N — CID 123154189
7-(3,6-difluorocyclohexa-1,5-dien-1-yl)-2-hept-5-en-3-yl-4-methyl-1,2,3,10-tetrahydroazecine (PubChem CID 123154189) has the molecular formula C23H31F2N and a molecular weight of 359.50 g/mol. Its IUPAC name is 7-(3,6-difluorocyclohexa-1,5-dien-1-yl)-2-hept-5-en-3-yl-4-methyl-1,2,3,10-tetrahydroazecine.
| Compound Name | 7-(3,6-difluorocyclohexa-1,5-dien-1-yl)-2-hept-5-en-3-yl-4-methyl-1,2,3,10-tetrahydroazecine |
|---|---|
| PubChem CID | 123154189 |
| Molecular Formula | C23H31F2N |
| Molecular Weight | 359.50 g/mol |
| Exact Mass | 359.24 |
| IUPAC Name | 7-(3,6-difluorocyclohexa-1,5-dien-1-yl)-2-hept-5-en-3-yl-4-methyl-1,2,3,10-tetrahydroazecine |
| SMILES | CC=CCC(CC)C1CC(C)=CC=C(C2=CC(F)CC=C2F)C=CCN1 |
| InChI | InChI=1S/C23H31F2N/c1-4-6-8-18(5-2)23-15-17(3)10-11-19(9-7-14-26-23)21-16-20(24)12-13-22(21)25/h4,6-7,9-11,13,16,18,20,23,26H,5,8,12,14-15H2,1-3H3 |
| InChIKey | KWFSMYOUKFLVLS-UHFFFAOYSA-N |
| XLogP | 6.29 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.50 |
| LogP ≤ 5 | 6.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|