C16H16FN — CID 70809943
10-fluoro-4,6a,7,10,11,11b-hexahydro-3H-benzo[c]carbazole (PubChem CID 70809943) has the molecular formula C16H16FN and a molecular weight of 241.31 g/mol. Its IUPAC name is 10-fluoro-4,6a,7,10,11,11b-hexahydro-3H-benzo[c]carbazole.
| Compound Name | 10-fluoro-4,6a,7,10,11,11b-hexahydro-3H-benzo[c]carbazole |
|---|---|
| PubChem CID | 70809943 |
| Molecular Formula | C16H16FN |
| Molecular Weight | 241.31 g/mol |
| Exact Mass | 241.13 |
| IUPAC Name | 10-fluoro-4,6a,7,10,11,11b-hexahydro-3H-benzo[c]carbazole |
| SMILES | FC1C=CC2=C(C1)C1C3=C(C=CC1N2)CCC=C3 |
| InChI | InChI=1S/C16H16FN/c17-11-6-8-14-13(9-11)16-12-4-2-1-3-10(12)5-7-15(16)18-14/h2,4-8,11,15-16,18H,1,3,9H2 |
| InChIKey | BVHRUCIICGBRJD-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.31 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |