C20H35F2N — CID 130242904
(6E,8Z)-9-[(Z)-1,2-difluoroethenyl]-N-ethyl-4,4,6-trimethyltrideca-6,8-dien-1-amine (PubChem CID 130242904) has the molecular formula C20H35F2N and a molecular weight of 327.50 g/mol. Its IUPAC name is (6E,8Z)-9-[(Z)-1,2-difluoroethenyl]-N-ethyl-4,4,6-trimethyltrideca-6,8-dien-1-amine.
| Compound Name | (6E,8Z)-9-[(Z)-1,2-difluoroethenyl]-N-ethyl-4,4,6-trimethyltrideca-6,8-dien-1-amine |
|---|---|
| PubChem CID | 130242904 |
| Molecular Formula | C20H35F2N |
| Molecular Weight | 327.50 g/mol |
| Exact Mass | 327.27 |
| IUPAC Name | (6E,8Z)-9-[(Z)-1,2-difluoroethenyl]-N-ethyl-4,4,6-trimethyltrideca-6,8-dien-1-amine |
| SMILES | CCCCC(=C/C=C(\C)CC(C)(C)CCCNCC)/C(F)=C/F |
| InChI | InChI=1S/C20H35F2N/c1-6-8-10-18(19(22)16-21)12-11-17(3)15-20(4,5)13-9-14-23-7-2/h11-12,16,23H,6-10,13-15H2,1-5H3/b17-11+,18-12-,19-16- |
| InChIKey | NUFNPHMFYHZSGK-GEALJCBXSA-N |
| XLogP | 6.64 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.50 |
| LogP ≤ 5 | 6.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|