C19H28F3N — CID 143153059
(4Z,5E,7Z)-5-prop-1-en-2-yl-N-propyl-4-[2-(trifluoromethyl)prop-2-enylidene]nona-5,7-dien-1-amine (PubChem CID 143153059) has the molecular formula C19H28F3N and a molecular weight of 327.43 g/mol. Its IUPAC name is (4Z,5E,7Z)-5-prop-1-en-2-yl-N-propyl-4-[2-(trifluoromethyl)prop-2-enylidene]nona-5,7-dien-1-amine.
| Compound Name | (4Z,5E,7Z)-5-prop-1-en-2-yl-N-propyl-4-[2-(trifluoromethyl)prop-2-enylidene]nona-5,7-dien-1-amine |
|---|---|
| PubChem CID | 143153059 |
| Molecular Formula | C19H28F3N |
| Molecular Weight | 327.43 g/mol |
| Exact Mass | 327.22 |
| IUPAC Name | (4Z,5E,7Z)-5-prop-1-en-2-yl-N-propyl-4-[2-(trifluoromethyl)prop-2-enylidene]nona-5,7-dien-1-amine |
| SMILES | C=C(C)C(=C\C=C/C)/C(=C\C(=C)C(F)(F)F)CCCNCCC |
| InChI | InChI=1S/C19H28F3N/c1-6-8-11-18(15(3)4)17(10-9-13-23-12-7-2)14-16(5)19(20,21)22/h6,8,11,14,23H,3,5,7,9-10,12-13H2,1-2,4H3/b8-6-,17-14-,18-11+ |
| InChIKey | MERBFIIAMTYPDO-KXAKOSAWSA-N |
| XLogP | 5.89 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.43 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|