C17H26F3N — CID 126728484
N-[(3Z,5E)-8,8,8-trifluoro-3-[(Z)-prop-1-enyl]octa-3,5-dienyl]cyclohexanamine (PubChem CID 126728484) has the molecular formula C17H26F3N and a molecular weight of 301.40 g/mol. Its IUPAC name is N-[(3Z,5E)-8,8,8-trifluoro-3-[(Z)-prop-1-enyl]octa-3,5-dienyl]cyclohexanamine.
| Compound Name | N-[(3Z,5E)-8,8,8-trifluoro-3-[(Z)-prop-1-enyl]octa-3,5-dienyl]cyclohexanamine |
|---|---|
| PubChem CID | 126728484 |
| Molecular Formula | C17H26F3N |
| Molecular Weight | 301.40 g/mol |
| Exact Mass | 301.20 |
| IUPAC Name | N-[(3Z,5E)-8,8,8-trifluoro-3-[(Z)-prop-1-enyl]octa-3,5-dienyl]cyclohexanamine |
| SMILES | C/C=C\C(=C/C=C/CC(F)(F)F)CCNC1CCCCC1 |
| InChI | InChI=1S/C17H26F3N/c1-2-8-15(9-6-7-13-17(18,19)20)12-14-21-16-10-4-3-5-11-16/h2,6-9,16,21H,3-5,10-14H2,1H3/b7-6+,8-2-,15-9+ |
| InChIKey | VUKRXOSTMVQGRU-BIBVGXBISA-N |
| XLogP | 5.31 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.40 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|