C21H39F2N — CID 123484686
14-fluoro-12-(fluoromethyl)-N,11,11-trimethyl-2-propyltetradeca-4,9-dien-1-amine (PubChem CID 123484686) has the molecular formula C21H39F2N and a molecular weight of 343.55 g/mol. Its IUPAC name is 14-fluoro-12-(fluoromethyl)-N,11,11-trimethyl-2-propyltetradeca-4,9-dien-1-amine.
| Compound Name | 14-fluoro-12-(fluoromethyl)-N,11,11-trimethyl-2-propyltetradeca-4,9-dien-1-amine |
|---|---|
| PubChem CID | 123484686 |
| Molecular Formula | C21H39F2N |
| Molecular Weight | 343.55 g/mol |
| Exact Mass | 343.31 |
| IUPAC Name | 14-fluoro-12-(fluoromethyl)-N,11,11-trimethyl-2-propyltetradeca-4,9-dien-1-amine |
| SMILES | CCCC(CC=CCCCC=CC(C)(C)C(CF)CCF)CNC |
| InChI | InChI=1S/C21H39F2N/c1-5-12-19(18-24-4)13-10-8-6-7-9-11-15-21(2,3)20(17-23)14-16-22/h8,10-11,15,19-20,24H,5-7,9,12-14,16-18H2,1-4H3 |
| InChIKey | BBUVBDURHGGFEO-UHFFFAOYSA-N |
| XLogP | 6.27 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.55 |
| LogP ≤ 5 | 6.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|