C15H30FN — CID 143769144
(Z)-10-fluoro-N,2,2,4,4-pentamethyldec-6-en-1-amine (PubChem CID 143769144) has the molecular formula C15H30FN and a molecular weight of 243.41 g/mol. Its IUPAC name is (Z)-10-fluoro-N,2,2,4,4-pentamethyldec-6-en-1-amine.
| Compound Name | (Z)-10-fluoro-N,2,2,4,4-pentamethyldec-6-en-1-amine |
|---|---|
| PubChem CID | 143769144 |
| Molecular Formula | C15H30FN |
| Molecular Weight | 243.41 g/mol |
| Exact Mass | 243.24 |
| IUPAC Name | (Z)-10-fluoro-N,2,2,4,4-pentamethyldec-6-en-1-amine |
| SMILES | CNCC(C)(C)CC(C)(C)C/C=C\CCCF |
| InChI | InChI=1S/C15H30FN/c1-14(2,10-8-6-7-9-11-16)12-15(3,4)13-17-5/h6,8,17H,7,9-13H2,1-5H3/b8-6- |
| InChIKey | REZVPICYNDQIAX-VURMDHGXSA-N |
| XLogP | 4.34 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.41 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|