C13H26FN — CID 123264703
7-(fluoromethyl)-N,2,8-trimethylnon-6-en-1-amine (PubChem CID 123264703) has the molecular formula C13H26FN and a molecular weight of 215.36 g/mol. Its IUPAC name is 7-(fluoromethyl)-N,2,8-trimethylnon-6-en-1-amine.
| Compound Name | 7-(fluoromethyl)-N,2,8-trimethylnon-6-en-1-amine |
|---|---|
| PubChem CID | 123264703 |
| Molecular Formula | C13H26FN |
| Molecular Weight | 215.36 g/mol |
| Exact Mass | 215.20 |
| IUPAC Name | 7-(fluoromethyl)-N,2,8-trimethylnon-6-en-1-amine |
| SMILES | CNCC(C)CCCC=C(CF)C(C)C |
| InChI | InChI=1S/C13H26FN/c1-11(2)13(9-14)8-6-5-7-12(3)10-15-4/h8,11-12,15H,5-7,9-10H2,1-4H3 |
| InChIKey | AYBNTKOFAPNWRQ-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.36 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|