C29H51N — CID 10431909
(2E,6E)-3,7,11-trimethyl-N-[(5E)-2,6,10-trimethylundeca-5,9-dienyl]dodeca-2,6,10-trien-1-amine (PubChem CID 10431909) has the molecular formula C29H51N and a molecular weight of 413.73 g/mol. Its IUPAC name is (2E,6E)-3,7,11-trimethyl-N-[(5E)-2,6,10-trimethylundeca-5,9-dienyl]dodeca-2,6,10-trien-1-amine.
| Compound Name | (2E,6E)-3,7,11-trimethyl-N-[(5E)-2,6,10-trimethylundeca-5,9-dienyl]dodeca-2,6,10-trien-1-amine |
|---|---|
| PubChem CID | 10431909 |
| Molecular Formula | C29H51N |
| Molecular Weight | 413.73 g/mol |
| Exact Mass | 413.40 |
| IUPAC Name | (2E,6E)-3,7,11-trimethyl-N-[(5E)-2,6,10-trimethylundeca-5,9-dienyl]dodeca-2,6,10-trien-1-amine |
| SMILES | CC(C)=CCC/C(C)=C/CC/C(C)=C/CNCC(C)CC/C=C(\C)CCC=C(C)C |
| InChI | InChI=1S/C29H51N/c1-24(2)13-9-15-26(5)17-11-19-28(7)21-22-30-23-29(8)20-12-18-27(6)16-10-14-25(3)4/h13-14,17-18,21,29-30H,9-12,15-16,19-20,22-23H2,1-8H3/b26-17+,27-18+,28-21+ |
| InChIKey | FJTBCGHISSWGME-BOHMWCSOSA-N |
| XLogP | 9.10 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.73 |
| LogP ≤ 5 | 9.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|