C23H42N2O — CID 54365770
3-(diethylamino)-4-(3,7,11-trimethyldodeca-2,6,10-trienylamino)butan-2-one (PubChem CID 54365770) has the molecular formula C23H42N2O and a molecular weight of 362.60 g/mol. Its IUPAC name is 3-(diethylamino)-4-(3,7,11-trimethyldodeca-2,6,10-trienylamino)butan-2-one.
| Compound Name | 3-(diethylamino)-4-(3,7,11-trimethyldodeca-2,6,10-trienylamino)butan-2-one |
|---|---|
| PubChem CID | 54365770 |
| Molecular Formula | C23H42N2O |
| Molecular Weight | 362.60 g/mol |
| Exact Mass | 362.33 |
| IUPAC Name | 3-(diethylamino)-4-(3,7,11-trimethyldodeca-2,6,10-trienylamino)butan-2-one |
| SMILES | CCN(CC)C(CNCC=C(C)CCC=C(C)CCC=C(C)C)C(C)=O |
| InChI | InChI=1S/C23H42N2O/c1-8-25(9-2)23(22(7)26)18-24-17-16-21(6)15-11-14-20(5)13-10-12-19(3)4/h12,14,16,23-24H,8-11,13,15,17-18H2,1-7H3 |
| InChIKey | UPQVSWJRTWJIHT-UHFFFAOYSA-N |
| XLogP | 5.29 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.60 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|