C19H28F2N2 — CID 167081314
(1Z)-3-N-[(2Z,8Z,10E)-10,12-difluoro-7-methyl-4-methylidenedodeca-2,8,10-trien-2-yl]-2-methylbuta-1,3-diene-1,3-diamine (PubChem CID 167081314) has the molecular formula C19H28F2N2 and a molecular weight of 322.44 g/mol. Its IUPAC name is (1Z)-3-N-[(2Z,8Z,10E)-10,12-difluoro-7-methyl-4-methylidenedodeca-2,8,10-trien-2-yl]-2-methylbuta-1,3-diene-1,3-diamine.
| Compound Name | (1Z)-3-N-[(2Z,8Z,10E)-10,12-difluoro-7-methyl-4-methylidenedodeca-2,8,10-trien-2-yl]-2-methylbuta-1,3-diene-1,3-diamine |
|---|---|
| PubChem CID | 167081314 |
| Molecular Formula | C19H28F2N2 |
| Molecular Weight | 322.44 g/mol |
| Exact Mass | 322.22 |
| IUPAC Name | (1Z)-3-N-[(2Z,8Z,10E)-10,12-difluoro-7-methyl-4-methylidenedodeca-2,8,10-trien-2-yl]-2-methylbuta-1,3-diene-1,3-diamine |
| SMILES | C=C(/C=C(/C)NC(=C)/C(C)=C\N)CCC(C)/C=C\C(F)=C/CF |
| InChI | InChI=1S/C19H28F2N2/c1-14(8-9-19(21)10-11-20)6-7-15(2)12-17(4)23-18(5)16(3)13-22/h8-10,12-14,23H,2,5-7,11,22H2,1,3-4H3/b9-8-,16-13-,17-12-,19-10+ |
| InChIKey | BEARLVZLXLOOCC-ANPYECITSA-N |
| XLogP | 5.21 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.44 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|