C18H30F3N3 — CID 146292251
(1E,3E,7E,8E)-7-ethylidene-1-N-methyl-2-propyl-9-N-(2,2,2-trifluoroethyl)deca-1,3,8-triene-1,6,9-triamine (PubChem CID 146292251) has the molecular formula C18H30F3N3 and a molecular weight of 345.45 g/mol. Its IUPAC name is (1E,3E,7E,8E)-7-ethylidene-1-N-methyl-2-propyl-9-N-(2,2,2-trifluoroethyl)deca-1,3,8-triene-1,6,9-triamine.
| Compound Name | (1E,3E,7E,8E)-7-ethylidene-1-N-methyl-2-propyl-9-N-(2,2,2-trifluoroethyl)deca-1,3,8-triene-1,6,9-triamine |
|---|---|
| PubChem CID | 146292251 |
| Molecular Formula | C18H30F3N3 |
| Molecular Weight | 345.45 g/mol |
| Exact Mass | 345.24 |
| IUPAC Name | (1E,3E,7E,8E)-7-ethylidene-1-N-methyl-2-propyl-9-N-(2,2,2-trifluoroethyl)deca-1,3,8-triene-1,6,9-triamine |
| SMILES | C/C=C(\C=C(/C)NCC(F)(F)F)C(N)C/C=C/C(=C/NC)CCC |
| InChI | InChI=1S/C18H30F3N3/c1-5-8-15(12-23-4)9-7-10-17(22)16(6-2)11-14(3)24-13-18(19,20)21/h6-7,9,11-12,17,23-24H,5,8,10,13,22H2,1-4H3/b9-7+,14-11+,15-12+,16-6+ |
| InChIKey | QCFKPCBGICJBKM-IKVWGPEDSA-N |
| XLogP | 4.17 |
| TPSA | 50.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.45 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|