C22H30F2N4 — CID 89085346
N-[(5Z,6E)-3-[(3E,5Z)-6-amino-7,7-difluorohepta-3,5-dien-3-yl]-6-(aminomethylidene)-5-prop-2-enylidenecyclohexa-1,3-dien-1-yl]piperidin-4-amine (PubChem CID 89085346) has the molecular formula C22H30F2N4 and a molecular weight of 388.51 g/mol. Its IUPAC name is N-[(5Z,6E)-3-[(3E,5Z)-6-amino-7,7-difluorohepta-3,5-dien-3-yl]-6-(aminomethylidene)-5-prop-2-enylidenecyclohexa-1,3-dien-1-yl]piperidin-4-amine.
| Compound Name | N-[(5Z,6E)-3-[(3E,5Z)-6-amino-7,7-difluorohepta-3,5-dien-3-yl]-6-(aminomethylidene)-5-prop-2-enylidenecyclohexa-1,3-dien-1-yl]piperidin-4-amine |
|---|---|
| PubChem CID | 89085346 |
| Molecular Formula | C22H30F2N4 |
| Molecular Weight | 388.51 g/mol |
| Exact Mass | 388.24 |
| IUPAC Name | N-[(5Z,6E)-3-[(3E,5Z)-6-amino-7,7-difluorohepta-3,5-dien-3-yl]-6-(aminomethylidene)-5-prop-2-enylidenecyclohexa-1,3-dien-1-yl]piperidin-4-amine |
| SMILES | C=C/C=c1/cc(/C(=C/C=C(\N)C(F)F)CC)cc(NC2CCNCC2)/c1=C/N |
| InChI | InChI=1S/C22H30F2N4/c1-3-5-16-12-17(15(4-2)6-7-20(26)22(23)24)13-21(19(16)14-25)28-18-8-10-27-11-9-18/h3,5-7,12-14,18,22,27-28H,1,4,8-11,25-26H2,2H3/b15-6+,16-5-,19-14+,20-7- |
| InChIKey | GYNIXLZZZDUNMH-VYPHWPBGSA-N |
| XLogP | 2.41 |
| TPSA | 76.10 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.51 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|