C23H33F4N3 — CID 129089637
(2Z,3E)-5-N-[(3E,5Z)-3-[(E)-2-amino-2-fluoroethenyl]-5-methylhepta-3,5-dien-2-yl]-2-[(E)-3-(trifluoromethyl)hex-2-enylidene]hexa-3,5-diene-1,5-diamine (PubChem CID 129089637) has the molecular formula C23H33F4N3 and a molecular weight of 427.53 g/mol. Its IUPAC name is (2Z,3E)-5-N-[(3E,5Z)-3-[(E)-2-amino-2-fluoroethenyl]-5-methylhepta-3,5-dien-2-yl]-2-[(E)-3-(trifluoromethyl)hex-2-enylidene]hexa-3,5-diene-1,5-diamine.
| Compound Name | (2Z,3E)-5-N-[(3E,5Z)-3-[(E)-2-amino-2-fluoroethenyl]-5-methylhepta-3,5-dien-2-yl]-2-[(E)-3-(trifluoromethyl)hex-2-enylidene]hexa-3,5-diene-1,5-diamine |
|---|---|
| PubChem CID | 129089637 |
| Molecular Formula | C23H33F4N3 |
| Molecular Weight | 427.53 g/mol |
| Exact Mass | 427.26 |
| IUPAC Name | (2Z,3E)-5-N-[(3E,5Z)-3-[(E)-2-amino-2-fluoroethenyl]-5-methylhepta-3,5-dien-2-yl]-2-[(E)-3-(trifluoromethyl)hex-2-enylidene]hexa-3,5-diene-1,5-diamine |
| SMILES | C=C(/C=C/C(=C/C=C(\CCC)C(F)(F)F)CN)NC(C)C(/C=C(\N)F)=C/C(C)=C\C |
| InChI | InChI=1S/C23H33F4N3/c1-6-8-21(23(25,26)27)12-11-19(15-28)10-9-17(4)30-18(5)20(14-22(24)29)13-16(3)7-2/h7,9-14,18,30H,4,6,8,15,28-29H2,1-3,5H3/b10-9+,16-7-,19-11-,20-13+,21-12+,22-14- |
| InChIKey | GKTGCMHTGLOWQZ-PUERWAHQSA-N |
| XLogP | 5.87 |
| TPSA | 64.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.53 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|