C16H25FN2 — CID 134187781
(3E,5Z)-6-N-(1-cyclopropylpropyl)-5-fluoro-3-prop-1-en-2-ylhepta-1,3,5-triene-2,6-diamine (PubChem CID 134187781) has the molecular formula C16H25FN2 and a molecular weight of 264.39 g/mol. Its IUPAC name is (3E,5Z)-6-N-(1-cyclopropylpropyl)-5-fluoro-3-prop-1-en-2-ylhepta-1,3,5-triene-2,6-diamine.
| Compound Name | (3E,5Z)-6-N-(1-cyclopropylpropyl)-5-fluoro-3-prop-1-en-2-ylhepta-1,3,5-triene-2,6-diamine |
|---|---|
| PubChem CID | 134187781 |
| Molecular Formula | C16H25FN2 |
| Molecular Weight | 264.39 g/mol |
| Exact Mass | 264.20 |
| IUPAC Name | (3E,5Z)-6-N-(1-cyclopropylpropyl)-5-fluoro-3-prop-1-en-2-ylhepta-1,3,5-triene-2,6-diamine |
| SMILES | C=C(C)/C(=C\C(F)=C(/C)NC(CC)C1CC1)C(=C)N |
| InChI | InChI=1S/C16H25FN2/c1-6-16(13-7-8-13)19-12(5)15(17)9-14(10(2)3)11(4)18/h9,13,16,19H,2,4,6-8,18H2,1,3,5H3/b14-9+,15-12- |
| InChIKey | ZULDYSXKOXSJID-QRHUXVGTSA-N |
| XLogP | 3.94 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.39 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|