C26H45FN2 — CID 126583214
5-N-cyclopropyl-5-N-[(E)-2-[(E)-2-fluoro-3-methylidenepent-1-enyl]dec-2-enyl]-4-methylhex-5-ene-1,5-diamine (PubChem CID 126583214) has the molecular formula C26H45FN2 and a molecular weight of 404.66 g/mol. Its IUPAC name is 5-N-cyclopropyl-5-N-[(E)-2-[(E)-2-fluoro-3-methylidenepent-1-enyl]dec-2-enyl]-4-methylhex-5-ene-1,5-diamine.
| Compound Name | 5-N-cyclopropyl-5-N-[(E)-2-[(E)-2-fluoro-3-methylidenepent-1-enyl]dec-2-enyl]-4-methylhex-5-ene-1,5-diamine |
|---|---|
| PubChem CID | 126583214 |
| Molecular Formula | C26H45FN2 |
| Molecular Weight | 404.66 g/mol |
| Exact Mass | 404.36 |
| IUPAC Name | 5-N-cyclopropyl-5-N-[(E)-2-[(E)-2-fluoro-3-methylidenepent-1-enyl]dec-2-enyl]-4-methylhex-5-ene-1,5-diamine |
| SMILES | C=C(CC)/C(F)=C\C(=C/CCCCCCC)CN(C(=C)C(C)CCCN)C1CC1 |
| InChI | InChI=1S/C26H45FN2/c1-6-8-9-10-11-12-15-24(19-26(27)21(3)7-2)20-29(25-16-17-25)23(5)22(4)14-13-18-28/h15,19,22,25H,3,5-14,16-18,20,28H2,1-2,4H3/b24-15+,26-19+ |
| InChIKey | WIHASUHXJVCFJV-CUNNRQKXSA-N |
| XLogP | 7.45 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.66 |
| LogP ≤ 5 | 7.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|