C21H41FN2 — CID 139423554
(2E,4Z)-3-N-ethyl-1-fluoro-3-N,13-N,13-N,5-tetramethylpentadeca-2,4-diene-3,13-diamine (PubChem CID 139423554) has the molecular formula C21H41FN2 and a molecular weight of 340.57 g/mol. Its IUPAC name is (2E,4Z)-3-N-ethyl-1-fluoro-3-N,13-N,13-N,5-tetramethylpentadeca-2,4-diene-3,13-diamine.
| Compound Name | (2E,4Z)-3-N-ethyl-1-fluoro-3-N,13-N,13-N,5-tetramethylpentadeca-2,4-diene-3,13-diamine |
|---|---|
| PubChem CID | 139423554 |
| Molecular Formula | C21H41FN2 |
| Molecular Weight | 340.57 g/mol |
| Exact Mass | 340.33 |
| IUPAC Name | (2E,4Z)-3-N-ethyl-1-fluoro-3-N,13-N,13-N,5-tetramethylpentadeca-2,4-diene-3,13-diamine |
| SMILES | CCC(CCCCCCC/C(C)=C\C(=C/CF)N(C)CC)N(C)C |
| InChI | InChI=1S/C21H41FN2/c1-7-20(23(4)5)15-13-11-9-10-12-14-19(3)18-21(16-17-22)24(6)8-2/h16,18,20H,7-15,17H2,1-6H3/b19-18-,21-16+ |
| InChIKey | UCFLHMHPBXVIKV-YZAQMJNISA-N |
| XLogP | 5.81 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.57 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|