C21H33F2N — CID 122647527
(3E)-N-[(2S)-4-[(1S,5R)-3,5-difluorocyclohex-3-en-1-yl]butan-2-yl]-6-methyl-N-prop-2-enylhepta-1,3-dien-3-amine (PubChem CID 122647527) has the molecular formula C21H33F2N and a molecular weight of 337.50 g/mol. Its IUPAC name is (3E)-N-[(2S)-4-[(1S,5R)-3,5-difluorocyclohex-3-en-1-yl]butan-2-yl]-6-methyl-N-prop-2-enylhepta-1,3-dien-3-amine.
| Compound Name | (3E)-N-[(2S)-4-[(1S,5R)-3,5-difluorocyclohex-3-en-1-yl]butan-2-yl]-6-methyl-N-prop-2-enylhepta-1,3-dien-3-amine |
|---|---|
| PubChem CID | 122647527 |
| Molecular Formula | C21H33F2N |
| Molecular Weight | 337.50 g/mol |
| Exact Mass | 337.26 |
| IUPAC Name | (3E)-N-[(2S)-4-[(1S,5R)-3,5-difluorocyclohex-3-en-1-yl]butan-2-yl]-6-methyl-N-prop-2-enylhepta-1,3-dien-3-amine |
| SMILES | C=CCN(/C(C=C)=C/CC(C)C)[C@@H](C)CC[C@@H]1CC(F)=C[C@H](F)C1 |
| InChI | InChI=1S/C21H33F2N/c1-6-12-24(21(7-2)11-8-16(3)4)17(5)9-10-18-13-19(22)15-20(23)14-18/h6-7,11,15-19H,1-2,8-10,12-14H2,3-5H3/b21-11+/t17-,18-,19+/m0/s1 |
| InChIKey | JHVLIRVBUXYJPQ-ZUWKYZGJSA-N |
| XLogP | 6.36 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.50 |
| LogP ≤ 5 | 6.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|