C21H32F7N — CID 87883104
1-fluoro-N-(1,1,2,9,9,9-hexafluorononyl)-N-(2-methylpentyl)cyclohexa-2,4-dien-1-amine (PubChem CID 87883104) has the molecular formula C21H32F7N and a molecular weight of 431.48 g/mol. Its IUPAC name is 1-fluoro-N-(1,1,2,9,9,9-hexafluorononyl)-N-(2-methylpentyl)cyclohexa-2,4-dien-1-amine.
| Compound Name | 1-fluoro-N-(1,1,2,9,9,9-hexafluorononyl)-N-(2-methylpentyl)cyclohexa-2,4-dien-1-amine |
|---|---|
| PubChem CID | 87883104 |
| Molecular Formula | C21H32F7N |
| Molecular Weight | 431.48 g/mol |
| Exact Mass | 431.24 |
| IUPAC Name | 1-fluoro-N-(1,1,2,9,9,9-hexafluorononyl)-N-(2-methylpentyl)cyclohexa-2,4-dien-1-amine |
| SMILES | CCCC(C)CN(C1(F)C=CC=CC1)C(F)(F)C(F)CCCCCCC(F)(F)F |
| InChI | InChI=1S/C21H32F7N/c1-3-11-17(2)16-29(19(23)13-8-6-9-14-19)21(27,28)18(22)12-7-4-5-10-15-20(24,25)26/h6,8-9,13,17-18H,3-5,7,10-12,14-16H2,1-2H3 |
| InChIKey | XQXFLXDJTWXZLO-UHFFFAOYSA-N |
| XLogP | 7.74 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.48 |
| LogP ≤ 5 | 7.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|