C16H21F8N — CID 87883095
1-fluoro-N-(fluoromethyl)-N-(1,1,2,9,9,9-hexafluorononyl)cyclohexa-2,4-dien-1-amine (PubChem CID 87883095) has the molecular formula C16H21F8N and a molecular weight of 379.34 g/mol. Its IUPAC name is 1-fluoro-N-(fluoromethyl)-N-(1,1,2,9,9,9-hexafluorononyl)cyclohexa-2,4-dien-1-amine.
| Compound Name | 1-fluoro-N-(fluoromethyl)-N-(1,1,2,9,9,9-hexafluorononyl)cyclohexa-2,4-dien-1-amine |
|---|---|
| PubChem CID | 87883095 |
| Molecular Formula | C16H21F8N |
| Molecular Weight | 379.34 g/mol |
| Exact Mass | 379.15 |
| IUPAC Name | 1-fluoro-N-(fluoromethyl)-N-(1,1,2,9,9,9-hexafluorononyl)cyclohexa-2,4-dien-1-amine |
| SMILES | FCN(C1(F)C=CC=CC1)C(F)(F)C(F)CCCCCCC(F)(F)F |
| InChI | InChI=1S/C16H21F8N/c17-12-25(14(19)9-5-3-6-10-14)16(23,24)13(18)8-4-1-2-7-11-15(20,21)22/h3,5-6,9,13H,1-2,4,7-8,10-12H2 |
| InChIKey | AFZQSAYSDCEWKH-UHFFFAOYSA-N |
| XLogP | 6.23 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.34 |
| LogP ≤ 5 | 6.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|