C25H21F16N — CID 141039606
2,3,4,5-tetrafluoro-N-(4-fluorobutyl)-N-(1,1,2,9,9,9-hexafluorononyl)-6-(2,3,4,5,6-pentafluorophenyl)aniline (PubChem CID 141039606) has the molecular formula C25H21F16N and a molecular weight of 639.42 g/mol. Its IUPAC name is 2,3,4,5-tetrafluoro-N-(4-fluorobutyl)-N-(1,1,2,9,9,9-hexafluorononyl)-6-(2,3,4,5,6-pentafluorophenyl)aniline.
| Compound Name | 2,3,4,5-tetrafluoro-N-(4-fluorobutyl)-N-(1,1,2,9,9,9-hexafluorononyl)-6-(2,3,4,5,6-pentafluorophenyl)aniline |
|---|---|
| PubChem CID | 141039606 |
| Molecular Formula | C25H21F16N |
| Molecular Weight | 639.42 g/mol |
| Exact Mass | 639.14 |
| IUPAC Name | 2,3,4,5-tetrafluoro-N-(4-fluorobutyl)-N-(1,1,2,9,9,9-hexafluorononyl)-6-(2,3,4,5,6-pentafluorophenyl)aniline |
| SMILES | FCCCCN(c1c(F)c(F)c(F)c(F)c1-c1c(F)c(F)c(F)c(F)c1F)C(F)(F)C(F)CCCCCCC(F)(F)F |
| InChI | InChI=1S/C25H21F16N/c26-9-5-6-10-42(25(40,41)11(27)7-3-1-2-4-8-24(37,38)39)23-13(16(30)19(33)21(35)22(23)36)12-14(28)17(31)20(34)18(32)15(12)29/h11H,1-10H2 |
| InChIKey | ORGBHJWRPWERRW-UHFFFAOYSA-N |
| XLogP | 10.00 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 639.42 |
| LogP ≤ 5 | 10.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|