C16H13F14N — CID 22637765
2,3,4,5,6-pentafluoro-N-hexyl-N-(1,1,2,2,3,3,4,4,4-nonafluorobutyl)aniline (PubChem CID 22637765) has the molecular formula C16H13F14N and a molecular weight of 485.26 g/mol. Its IUPAC name is 2,3,4,5,6-pentafluoro-N-hexyl-N-(1,1,2,2,3,3,4,4,4-nonafluorobutyl)aniline.
| Compound Name | 2,3,4,5,6-pentafluoro-N-hexyl-N-(1,1,2,2,3,3,4,4,4-nonafluorobutyl)aniline |
|---|---|
| PubChem CID | 22637765 |
| Molecular Formula | C16H13F14N |
| Molecular Weight | 485.26 g/mol |
| Exact Mass | 485.08 |
| IUPAC Name | 2,3,4,5,6-pentafluoro-N-hexyl-N-(1,1,2,2,3,3,4,4,4-nonafluorobutyl)aniline |
| SMILES | CCCCCCN(c1c(F)c(F)c(F)c(F)c1F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C16H13F14N/c1-2-3-4-5-6-31(12-10(20)8(18)7(17)9(19)11(12)21)16(29,30)14(24,25)13(22,23)15(26,27)28/h2-6H2,1H3 |
| InChIKey | AUJBSMJSGMGOQC-UHFFFAOYSA-N |
| XLogP | 7.19 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.26 |
| LogP ≤ 5 | 7.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|