C21H20F9N — CID 141039655
2,3,4,5-tetrafluoro-N-hexyl-6-(2,3,4,5,6-pentafluorophenyl)-N-propylaniline (PubChem CID 141039655) has the molecular formula C21H20F9N and a molecular weight of 457.38 g/mol. Its IUPAC name is 2,3,4,5-tetrafluoro-N-hexyl-6-(2,3,4,5,6-pentafluorophenyl)-N-propylaniline.
| Compound Name | 2,3,4,5-tetrafluoro-N-hexyl-6-(2,3,4,5,6-pentafluorophenyl)-N-propylaniline |
|---|---|
| PubChem CID | 141039655 |
| Molecular Formula | C21H20F9N |
| Molecular Weight | 457.38 g/mol |
| Exact Mass | 457.15 |
| IUPAC Name | 2,3,4,5-tetrafluoro-N-hexyl-6-(2,3,4,5,6-pentafluorophenyl)-N-propylaniline |
| SMILES | CCCCCCN(CCC)c1c(F)c(F)c(F)c(F)c1-c1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C21H20F9N/c1-3-5-6-7-9-31(8-4-2)21-11(14(24)17(27)19(29)20(21)30)10-12(22)15(25)18(28)16(26)13(10)23/h3-9H2,1-2H3 |
| InChIKey | XFOZQJLQDDRYAE-UHFFFAOYSA-N |
| XLogP | 7.40 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.38 |
| LogP ≤ 5 | 7.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|