C11H12F5NO — CID 61425430
2-(2,3,4,5,6-pentafluoro-N-propylanilino)ethanol (PubChem CID 61425430) has the molecular formula C11H12F5NO and a molecular weight of 269.21 g/mol. Its IUPAC name is 2-(2,3,4,5,6-pentafluoro-N-propylanilino)ethanol.
| Compound Name | 2-(2,3,4,5,6-pentafluoro-N-propylanilino)ethanol |
|---|---|
| PubChem CID | 61425430 |
| Molecular Formula | C11H12F5NO |
| Molecular Weight | 269.21 g/mol |
| Exact Mass | 269.08 |
| IUPAC Name | 2-(2,3,4,5,6-pentafluoro-N-propylanilino)ethanol |
| SMILES | CCCN(CCO)c1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C11H12F5NO/c1-2-3-17(4-5-18)11-9(15)7(13)6(12)8(14)10(11)16/h18H,2-5H2,1H3 |
| InChIKey | HRNIITXIHHFEDX-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.21 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|