C11H16Cl2N2O — CID 106890073
2-(4-amino-2,6-dichloro-N-propylanilino)ethanol (PubChem CID 106890073) has the molecular formula C11H16Cl2N2O and a molecular weight of 263.17 g/mol. Its IUPAC name is 2-(4-amino-2,6-dichloro-N-propylanilino)ethanol.
| Compound Name | 2-(4-amino-2,6-dichloro-N-propylanilino)ethanol |
|---|---|
| PubChem CID | 106890073 |
| Molecular Formula | C11H16Cl2N2O |
| Molecular Weight | 263.17 g/mol |
| Exact Mass | 262.06 |
| IUPAC Name | 2-(4-amino-2,6-dichloro-N-propylanilino)ethanol |
| SMILES | CCCN(CCO)c1c(Cl)cc(N)cc1Cl |
| InChI | InChI=1S/C11H16Cl2N2O/c1-2-3-15(4-5-16)11-9(12)6-8(14)7-10(11)13/h6-7,16H,2-5,14H2,1H3 |
| InChIKey | VGSQTAGRBKBKCD-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 49.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.17 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|