C13H17F4N — CID 22637585
2,3,4,6-tetrafluoro-5-methyl-N,N-dipropylaniline (PubChem CID 22637585) has the molecular formula C13H17F4N and a molecular weight of 263.28 g/mol. Its IUPAC name is 2,3,4,6-tetrafluoro-5-methyl-N,N-dipropylaniline.
| Compound Name | 2,3,4,6-tetrafluoro-5-methyl-N,N-dipropylaniline |
|---|---|
| PubChem CID | 22637585 |
| Molecular Formula | C13H17F4N |
| Molecular Weight | 263.28 g/mol |
| Exact Mass | 263.13 |
| IUPAC Name | 2,3,4,6-tetrafluoro-5-methyl-N,N-dipropylaniline |
| SMILES | CCCN(CCC)c1c(F)c(C)c(F)c(F)c1F |
| InChI | InChI=1S/C13H17F4N/c1-4-6-18(7-5-2)13-10(15)8(3)9(14)11(16)12(13)17/h4-7H2,1-3H3 |
| InChIKey | SURIUBDMAQGZSG-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.28 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|