C15H25N — CID 50937082
2,4,6-trimethyl-N,N-dipropylaniline (PubChem CID 50937082) has the molecular formula C15H25N and a molecular weight of 219.37 g/mol. Its IUPAC name is 2,4,6-trimethyl-N,N-dipropylaniline.
| Compound Name | 2,4,6-trimethyl-N,N-dipropylaniline |
|---|---|
| PubChem CID | 50937082 |
| Molecular Formula | C15H25N |
| Molecular Weight | 219.37 g/mol |
| Exact Mass | 219.20 |
| IUPAC Name | 2,4,6-trimethyl-N,N-dipropylaniline |
| SMILES | CCCN(CCC)c1c(C)cc(C)cc1C |
| InChI | InChI=1S/C15H25N/c1-6-8-16(9-7-2)15-13(4)10-12(3)11-14(15)5/h10-11H,6-9H2,1-5H3 |
| InChIKey | SEHNTHAWANRWKI-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.37 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |