C13H22N2 — CID 115549884
3-methyl-2-N,2-N-dipropylbenzene-1,2-diamine (PubChem CID 115549884) has the molecular formula C13H22N2 and a molecular weight of 206.33 g/mol. Its IUPAC name is 3-methyl-2-N,2-N-dipropylbenzene-1,2-diamine.
| Compound Name | 3-methyl-2-N,2-N-dipropylbenzene-1,2-diamine |
|---|---|
| PubChem CID | 115549884 |
| Molecular Formula | C13H22N2 |
| Molecular Weight | 206.33 g/mol |
| Exact Mass | 206.18 |
| IUPAC Name | 3-methyl-2-N,2-N-dipropylbenzene-1,2-diamine |
| SMILES | CCCN(CCC)c1c(C)cccc1N |
| InChI | InChI=1S/C13H22N2/c1-4-9-15(10-5-2)13-11(3)7-6-8-12(13)14/h6-8H,4-5,9-10,14H2,1-3H3 |
| InChIKey | AUBYKQFMGVZPEV-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.33 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|