C10H16N2 — CID 115550058
2-N-ethyl-2-N,3-dimethylbenzene-1,2-diamine (PubChem CID 115550058) has the molecular formula C10H16N2 and a molecular weight of 164.25 g/mol. Its IUPAC name is 2-N-ethyl-2-N,3-dimethylbenzene-1,2-diamine.
| Compound Name | 2-N-ethyl-2-N,3-dimethylbenzene-1,2-diamine |
|---|---|
| PubChem CID | 115550058 |
| Molecular Formula | C10H16N2 |
| Molecular Weight | 164.25 g/mol |
| Exact Mass | 164.13 |
| IUPAC Name | 2-N-ethyl-2-N,3-dimethylbenzene-1,2-diamine |
| SMILES | CCN(C)c1c(C)cccc1N |
| InChI | InChI=1S/C10H16N2/c1-4-12(3)10-8(2)6-5-7-9(10)11/h5-7H,4,11H2,1-3H3 |
| InChIKey | PFSVAGVDQDJIBQ-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 164.25 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|