C16H22N2 — CID 139621321
1-N,1-N-dipropylnaphthalene-1,5-diamine (PubChem CID 139621321) has the molecular formula C16H22N2 and a molecular weight of 242.37 g/mol. Its IUPAC name is 1-N,1-N-dipropylnaphthalene-1,5-diamine.
| Compound Name | 1-N,1-N-dipropylnaphthalene-1,5-diamine |
|---|---|
| PubChem CID | 139621321 |
| Molecular Formula | C16H22N2 |
| Molecular Weight | 242.37 g/mol |
| Exact Mass | 242.18 |
| IUPAC Name | 1-N,1-N-dipropylnaphthalene-1,5-diamine |
| SMILES | CCCN(CCC)c1cccc2c(N)cccc12 |
| InChI | InChI=1S/C16H22N2/c1-3-11-18(12-4-2)16-10-6-7-13-14(16)8-5-9-15(13)17/h5-10H,3-4,11-12,17H2,1-2H3 |
| InChIKey | GSXHUWJECSPOEW-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.37 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|