C16H27N — CID 100917562
N,N-dibutyl-2,6-dimethylaniline (PubChem CID 100917562) has the molecular formula C16H27N and a molecular weight of 233.40 g/mol. Its IUPAC name is N,N-dibutyl-2,6-dimethylaniline.
| Compound Name | N,N-dibutyl-2,6-dimethylaniline |
|---|---|
| PubChem CID | 100917562 |
| Molecular Formula | C16H27N |
| Molecular Weight | 233.40 g/mol |
| Exact Mass | 233.21 |
| IUPAC Name | N,N-dibutyl-2,6-dimethylaniline |
| SMILES | CCCCN(CCCC)c1c(C)cccc1C |
| InChI | InChI=1S/C16H27N/c1-5-7-12-17(13-8-6-2)16-14(3)10-9-11-15(16)4/h9-11H,5-8,12-13H2,1-4H3 |
| InChIKey | TZLZOPCIJDTZGU-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.40 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |