3-(N-heptyl-2,6-dimethylanilino)-2-methylpropanoic acid

C19H31NO2 — CID 82319077

IUPAC3-(N-heptyl-2,6-dimethylanilino)-2-methylpropanoic acid
SMILESCCCCCCCN(CC(C)C(=O)O)c1c(C)cccc1C
InChIInChI=1S/C19H31NO2/c1-5-6-7-8-9-13-20(14-17(4)19(21)22)18-15(2)11-10-12-16(18)3/h10-12,17H,5-9,13-14H2,1-4H3,(H,21,22)
InChIKeyFTYANESORUTOOZ-UHFFFAOYSA-N
MW305.46 g/mol
LogP4.80
Rot. Bonds10

About 3-(N-heptyl-2,6-dimethylanilino)-2-methylpropanoic acid

3-(N-heptyl-2,6-dimethylanilino)-2-methylpropanoic acid (PubChem CID 82319077) has the molecular formula C19H31NO2 and a molecular weight of 305.46 g/mol. Its IUPAC name is 3-(N-heptyl-2,6-dimethylanilino)-2-methylpropanoic acid.

Molecular Properties

Compound Name3-(N-heptyl-2,6-dimethylanilino)-2-methylpropanoic acid
PubChem CID82319077
Molecular FormulaC19H31NO2
Molecular Weight305.46 g/mol
Exact Mass305.24
IUPAC Name3-(N-heptyl-2,6-dimethylanilino)-2-methylpropanoic acid
SMILESCCCCCCCN(CC(C)C(=O)O)c1c(C)cccc1C
InChIInChI=1S/C19H31NO2/c1-5-6-7-8-9-13-20(14-17(4)19(21)22)18-15(2)11-10-12-16(18)3/h10-12,17H,5-9,13-14H2,1-4H3,(H,21,22)
InChIKeyFTYANESORUTOOZ-UHFFFAOYSA-N
XLogP4.80
TPSA40.54 Ų
H-Bond Donors1
H-Bond Acceptors2
Rotatable Bonds10
Heavy Atoms22
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500305.46
LogP ≤ 54.80
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}

Analyze 3-(N-heptyl-2,6-dimethylanilino)-2-methylpropanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-(N-heptyl-2,6-dimethylanilino)-2-methylpropanoic acid?
The IUPAC name of 3-(N-heptyl-2,6-dimethylanilino)-2-methylpropanoic acid (CID 82319077) is 3-(N-heptyl-2,6-dimethylanilino)-2-methylpropanoic acid.
What is the SMILES notation for 3-(N-heptyl-2,6-dimethylanilino)-2-methylpropanoic acid?
The canonical SMILES for 3-(N-heptyl-2,6-dimethylanilino)-2-methylpropanoic acid is CCCCCCCN(CC(C)C(=O)O)c1c(C)cccc1C.
What is the InChIKey of 3-(N-heptyl-2,6-dimethylanilino)-2-methylpropanoic acid?
The InChIKey is FTYANESORUTOOZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H31NO2/c1-5-6-7-8-9-13-20(14-17(4)19(21)22)18-15(2)11-10-12-16(18)3/h10-12,17H,5-9,13-14H2,1-4H3,(H,21,22).
What are the key properties of 3-(N-heptyl-2,6-dimethylanilino)-2-methylpropanoic acid?
3-(N-heptyl-2,6-dimethylanilino)-2-methylpropanoic acid has a molecular weight of 305.46 g/mol, XLogP of 4.80, 10 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(N-heptyl-2,6-dimethylanilino)-2-methylpropanoic acid is sourced from PubChem (CID 82319077), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).