3-(N-butyl-2,4,6-trimethylanilino)-2-methylpropanoic acid

C17H27NO2 — CID 82318042

IUPAC3-(N-butyl-2,4,6-trimethylanilino)-2-methylpropanoic acid
SMILESCCCCN(CC(C)C(=O)O)c1c(C)cc(C)cc1C
InChIInChI=1S/C17H27NO2/c1-6-7-8-18(11-15(5)17(19)20)16-13(3)9-12(2)10-14(16)4/h9-10,15H,6-8,11H2,1-5H3,(H,19,20)
InChIKeyPUSBHCGOQJHFFH-UHFFFAOYSA-N
MW277.41 g/mol
LogP3.94
Rot. Bonds7

About 3-(N-butyl-2,4,6-trimethylanilino)-2-methylpropanoic acid

3-(N-butyl-2,4,6-trimethylanilino)-2-methylpropanoic acid (PubChem CID 82318042) has the molecular formula C17H27NO2 and a molecular weight of 277.41 g/mol. Its IUPAC name is 3-(N-butyl-2,4,6-trimethylanilino)-2-methylpropanoic acid.

Molecular Properties

Compound Name3-(N-butyl-2,4,6-trimethylanilino)-2-methylpropanoic acid
PubChem CID82318042
Molecular FormulaC17H27NO2
Molecular Weight277.41 g/mol
Exact Mass277.20
IUPAC Name3-(N-butyl-2,4,6-trimethylanilino)-2-methylpropanoic acid
SMILESCCCCN(CC(C)C(=O)O)c1c(C)cc(C)cc1C
InChIInChI=1S/C17H27NO2/c1-6-7-8-18(11-15(5)17(19)20)16-13(3)9-12(2)10-14(16)4/h9-10,15H,6-8,11H2,1-5H3,(H,19,20)
InChIKeyPUSBHCGOQJHFFH-UHFFFAOYSA-N
XLogP3.94
TPSA40.54 Ų
H-Bond Donors1
H-Bond Acceptors2
Rotatable Bonds7
Heavy Atoms20
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500277.41
LogP ≤ 53.94
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 102

Analyze 3-(N-butyl-2,4,6-trimethylanilino)-2-methylpropanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-(N-butyl-2,4,6-trimethylanilino)-2-methylpropanoic acid?
The IUPAC name of 3-(N-butyl-2,4,6-trimethylanilino)-2-methylpropanoic acid (CID 82318042) is 3-(N-butyl-2,4,6-trimethylanilino)-2-methylpropanoic acid.
What is the SMILES notation for 3-(N-butyl-2,4,6-trimethylanilino)-2-methylpropanoic acid?
The canonical SMILES for 3-(N-butyl-2,4,6-trimethylanilino)-2-methylpropanoic acid is CCCCN(CC(C)C(=O)O)c1c(C)cc(C)cc1C.
What is the InChIKey of 3-(N-butyl-2,4,6-trimethylanilino)-2-methylpropanoic acid?
The InChIKey is PUSBHCGOQJHFFH-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H27NO2/c1-6-7-8-18(11-15(5)17(19)20)16-13(3)9-12(2)10-14(16)4/h9-10,15H,6-8,11H2,1-5H3,(H,19,20).
What are the key properties of 3-(N-butyl-2,4,6-trimethylanilino)-2-methylpropanoic acid?
3-(N-butyl-2,4,6-trimethylanilino)-2-methylpropanoic acid has a molecular weight of 277.41 g/mol, XLogP of 3.94, 7 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(N-butyl-2,4,6-trimethylanilino)-2-methylpropanoic acid is sourced from PubChem (CID 82318042), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).