C15H25NO2 — CID 21413032
1-[N-(1-hydroxypropyl)-2,4,6-trimethylanilino]propan-1-ol (PubChem CID 21413032) has the molecular formula C15H25NO2 and a molecular weight of 251.37 g/mol. Its IUPAC name is 1-[N-(1-hydroxypropyl)-2,4,6-trimethylanilino]propan-1-ol.
| Compound Name | 1-[N-(1-hydroxypropyl)-2,4,6-trimethylanilino]propan-1-ol |
|---|---|
| PubChem CID | 21413032 |
| Molecular Formula | C15H25NO2 |
| Molecular Weight | 251.37 g/mol |
| Exact Mass | 251.19 |
| IUPAC Name | 1-[N-(1-hydroxypropyl)-2,4,6-trimethylanilino]propan-1-ol |
| SMILES | CCC(O)N(c1c(C)cc(C)cc1C)C(O)CC |
| InChI | InChI=1S/C15H25NO2/c1-6-13(17)16(14(18)7-2)15-11(4)8-10(3)9-12(15)5/h8-9,13-14,17-18H,6-7H2,1-5H3 |
| InChIKey | MLIXVEWXVHALKT-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 43.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.37 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|