C23H24F9N — CID 141039561
N-ethyl-2,3,4,5-tetrafluoro-N-nonyl-6-(2,3,4,5,6-pentafluorophenyl)aniline (PubChem CID 141039561) has the molecular formula C23H24F9N and a molecular weight of 485.43 g/mol. Its IUPAC name is N-ethyl-2,3,4,5-tetrafluoro-N-nonyl-6-(2,3,4,5,6-pentafluorophenyl)aniline.
| Compound Name | N-ethyl-2,3,4,5-tetrafluoro-N-nonyl-6-(2,3,4,5,6-pentafluorophenyl)aniline |
|---|---|
| PubChem CID | 141039561 |
| Molecular Formula | C23H24F9N |
| Molecular Weight | 485.43 g/mol |
| Exact Mass | 485.18 |
| IUPAC Name | N-ethyl-2,3,4,5-tetrafluoro-N-nonyl-6-(2,3,4,5,6-pentafluorophenyl)aniline |
| SMILES | CCCCCCCCCN(CC)c1c(F)c(F)c(F)c(F)c1-c1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C23H24F9N/c1-3-5-6-7-8-9-10-11-33(4-2)23-13(16(26)19(29)21(31)22(23)32)12-14(24)17(27)20(30)18(28)15(12)25/h3-11H2,1-2H3 |
| InChIKey | ZIQCZXGFZPSMDA-UHFFFAOYSA-N |
| XLogP | 8.18 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.43 |
| LogP ≤ 5 | 8.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|