C20H13F10NO2 — CID 91732053
2,3,4,5,6-pentafluoro-N-hexyl-N-(2,3,4,5,6-pentafluorobenzoyl)benzamide (PubChem CID 91732053) has the molecular formula C20H13F10NO2 and a molecular weight of 489.31 g/mol. Its IUPAC name is 2,3,4,5,6-pentafluoro-N-hexyl-N-(2,3,4,5,6-pentafluorobenzoyl)benzamide.
| Compound Name | 2,3,4,5,6-pentafluoro-N-hexyl-N-(2,3,4,5,6-pentafluorobenzoyl)benzamide |
|---|---|
| PubChem CID | 91732053 |
| Molecular Formula | C20H13F10NO2 |
| Molecular Weight | 489.31 g/mol |
| Exact Mass | 489.08 |
| IUPAC Name | 2,3,4,5,6-pentafluoro-N-hexyl-N-(2,3,4,5,6-pentafluorobenzoyl)benzamide |
| SMILES | CCCCCCN(C(=O)c1c(F)c(F)c(F)c(F)c1F)C(=O)c1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C20H13F10NO2/c1-2-3-4-5-6-31(19(32)7-9(21)13(25)17(29)14(26)10(7)22)20(33)8-11(23)15(27)18(30)16(28)12(8)24/h2-6H2,1H3 |
| InChIKey | XNWDAVYFOCAMLC-UHFFFAOYSA-N |
| XLogP | 5.94 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.31 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|