C15H13F5O — CID 24773081
1-(2,3,4,5,6-pentafluorophenyl)non-2-yn-1-one (PubChem CID 24773081) has the molecular formula C15H13F5O and a molecular weight of 304.26 g/mol. Its IUPAC name is 1-(2,3,4,5,6-pentafluorophenyl)non-2-yn-1-one.
| Compound Name | 1-(2,3,4,5,6-pentafluorophenyl)non-2-yn-1-one |
|---|---|
| PubChem CID | 24773081 |
| Molecular Formula | C15H13F5O |
| Molecular Weight | 304.26 g/mol |
| Exact Mass | 304.09 |
| IUPAC Name | 1-(2,3,4,5,6-pentafluorophenyl)non-2-yn-1-one |
| SMILES | CCCCCCC#CC(=O)c1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C15H13F5O/c1-2-3-4-5-6-7-8-9(21)10-11(16)13(18)15(20)14(19)12(10)17/h2-6H2,1H3 |
| InChIKey | XAIYGJYICJGQCW-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.26 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|