C24H35F8N — CID 22637440
2,3-difluoro-N-(1,1,2,2,3,3-hexafluorononyl)-N-nonylaniline (PubChem CID 22637440) has the molecular formula C24H35F8N and a molecular weight of 489.54 g/mol. Its IUPAC name is 2,3-difluoro-N-(1,1,2,2,3,3-hexafluorononyl)-N-nonylaniline.
| Compound Name | 2,3-difluoro-N-(1,1,2,2,3,3-hexafluorononyl)-N-nonylaniline |
|---|---|
| PubChem CID | 22637440 |
| Molecular Formula | C24H35F8N |
| Molecular Weight | 489.54 g/mol |
| Exact Mass | 489.26 |
| IUPAC Name | 2,3-difluoro-N-(1,1,2,2,3,3-hexafluorononyl)-N-nonylaniline |
| SMILES | CCCCCCCCCN(c1cccc(F)c1F)C(F)(F)C(F)(F)C(F)(F)CCCCCC |
| InChI | InChI=1S/C24H35F8N/c1-3-5-7-9-10-11-13-18-33(20-16-14-15-19(25)21(20)26)24(31,32)23(29,30)22(27,28)17-12-8-6-4-2/h14-16H,3-13,17-18H2,1-2H3 |
| InChIKey | ITDHUNRPVWXTCK-UHFFFAOYSA-N |
| XLogP | 9.36 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.54 |
| LogP ≤ 5 | 9.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|